C9H16BrNO2 — CID 107903459
2-bromo-1-(2,2-dimethylmorpholin-4-yl)propan-1-one (PubChem CID 107903459) has the molecular formula C9H16BrNO2 and a molecular weight of 250.14 g/mol. Its IUPAC name is 2-bromo-1-(2,2-dimethylmorpholin-4-yl)propan-1-one.
| Compound Name | 2-bromo-1-(2,2-dimethylmorpholin-4-yl)propan-1-one |
|---|---|
| PubChem CID | 107903459 |
| Molecular Formula | C9H16BrNO2 |
| Molecular Weight | 250.14 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | 2-bromo-1-(2,2-dimethylmorpholin-4-yl)propan-1-one |
| SMILES | CC(Br)C(=O)N1CCOC(C)(C)C1 |
| InChI | InChI=1S/C9H16BrNO2/c1-7(10)8(12)11-4-5-13-9(2,3)6-11/h7H,4-6H2,1-3H3 |
| InChIKey | QPYGMQOBCPAZEJ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.14 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|