C10H17ClN2O3 — CID 43593160
N-(2-chloropropanoyl)-2,2-dimethylmorpholine-4-carboxamide (PubChem CID 43593160) has the molecular formula C10H17ClN2O3 and a molecular weight of 248.71 g/mol. Its IUPAC name is N-(2-chloropropanoyl)-2,2-dimethylmorpholine-4-carboxamide.
| Compound Name | N-(2-chloropropanoyl)-2,2-dimethylmorpholine-4-carboxamide |
|---|---|
| PubChem CID | 43593160 |
| Molecular Formula | C10H17ClN2O3 |
| Molecular Weight | 248.71 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | N-(2-chloropropanoyl)-2,2-dimethylmorpholine-4-carboxamide |
| SMILES | CC(Cl)C(=O)NC(=O)N1CCOC(C)(C)C1 |
| InChI | InChI=1S/C10H17ClN2O3/c1-7(11)8(14)12-9(15)13-4-5-16-10(2,3)6-13/h7H,4-6H2,1-3H3,(H,12,14,15) |
| InChIKey | GCKCWSKMXGHHIP-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.71 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|