C10H15ClN2O5 — CID 113330591
methyl 4-(2-chloropropanoylcarbamoyl)morpholine-2-carboxylate (PubChem CID 113330591) has the molecular formula C10H15ClN2O5 and a molecular weight of 278.69 g/mol. Its IUPAC name is methyl 4-(2-chloropropanoylcarbamoyl)morpholine-2-carboxylate.
| Compound Name | methyl 4-(2-chloropropanoylcarbamoyl)morpholine-2-carboxylate |
|---|---|
| PubChem CID | 113330591 |
| Molecular Formula | C10H15ClN2O5 |
| Molecular Weight | 278.69 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | methyl 4-(2-chloropropanoylcarbamoyl)morpholine-2-carboxylate |
| SMILES | COC(=O)C1CN(C(=O)NC(=O)C(C)Cl)CCO1 |
| InChI | InChI=1S/C10H15ClN2O5/c1-6(11)8(14)12-10(16)13-3-4-18-7(5-13)9(15)17-2/h6-7H,3-5H2,1-2H3,(H,12,14,16) |
| InChIKey | FFSFZLCPHALSSZ-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.69 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|