C11H16N2O8 — CID 115535343
2-[(2-methoxycarbonylmorpholine-4-carbonyl)amino]butanedioic acid (PubChem CID 115535343) has the molecular formula C11H16N2O8 and a molecular weight of 304.26 g/mol. Its IUPAC name is 2-[(2-methoxycarbonylmorpholine-4-carbonyl)amino]butanedioic acid.
| Compound Name | 2-[(2-methoxycarbonylmorpholine-4-carbonyl)amino]butanedioic acid |
|---|---|
| PubChem CID | 115535343 |
| Molecular Formula | C11H16N2O8 |
| Molecular Weight | 304.26 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 2-[(2-methoxycarbonylmorpholine-4-carbonyl)amino]butanedioic acid |
| SMILES | COC(=O)C1CN(C(=O)NC(CC(=O)O)C(=O)O)CCO1 |
| InChI | InChI=1S/C11H16N2O8/c1-20-10(18)7-5-13(2-3-21-7)11(19)12-6(9(16)17)4-8(14)15/h6-7H,2-5H2,1H3,(H,12,19)(H,14,15)(H,16,17) |
| InChIKey | YWPIGLFAJWJSDE-UHFFFAOYSA-N |
| XLogP | -1.50 |
| TPSA | 142.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.26 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |