C16H22N2O3 — CID 48630543
N-(4-acetylphenyl)-2,2,6-trimethylmorpholine-4-carboxamide (PubChem CID 48630543) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is N-(4-acetylphenyl)-2,2,6-trimethylmorpholine-4-carboxamide.
| Compound Name | N-(4-acetylphenyl)-2,2,6-trimethylmorpholine-4-carboxamide |
|---|---|
| PubChem CID | 48630543 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | N-(4-acetylphenyl)-2,2,6-trimethylmorpholine-4-carboxamide |
| SMILES | CC(=O)c1ccc(NC(=O)N2CC(C)OC(C)(C)C2)cc1 |
| InChI | InChI=1S/C16H22N2O3/c1-11-9-18(10-16(3,4)21-11)15(20)17-14-7-5-13(6-8-14)12(2)19/h5-8,11H,9-10H2,1-4H3,(H,17,20) |
| InChIKey | ZNGVXXYMQZQOBP-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |