C17H21N3O4 — CID 50979570
(3aS,6aS)-5-[(4-acetylphenyl)carbamoyl]-2-methyl-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid (PubChem CID 50979570) has the molecular formula C17H21N3O4 and a molecular weight of 331.37 g/mol. Its IUPAC name is (3aS,6aS)-5-[(4-acetylphenyl)carbamoyl]-2-methyl-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aS,6aS)-5-[(4-acetylphenyl)carbamoyl]-2-methyl-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 50979570 |
| Molecular Formula | C17H21N3O4 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | (3aS,6aS)-5-[(4-acetylphenyl)carbamoyl]-2-methyl-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid |
| SMILES | CC(=O)c1ccc(NC(=O)N2C[C@@H]3CN(C)C[C@]3(C(=O)O)C2)cc1 |
| InChI | InChI=1S/C17H21N3O4/c1-11(21)12-3-5-14(6-4-12)18-16(24)20-8-13-7-19(2)9-17(13,10-20)15(22)23/h3-6,13H,7-10H2,1-2H3,(H,18,24)(H,22,23)/t13-,17-/m0/s1 |
| InChIKey | GUMNUGCJJUQXFP-GUYCJALGSA-N |
| XLogP | 1.37 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |