C19H31N3O — CID 59231299
N-[(4-aminocyclohexyl)methyl]-4-(2,6-dimethylmorpholin-4-yl)aniline (PubChem CID 59231299) has the molecular formula C19H31N3O and a molecular weight of 317.48 g/mol. Its IUPAC name is N-[(4-aminocyclohexyl)methyl]-4-(2,6-dimethylmorpholin-4-yl)aniline.
| Compound Name | N-[(4-aminocyclohexyl)methyl]-4-(2,6-dimethylmorpholin-4-yl)aniline |
|---|---|
| PubChem CID | 59231299 |
| Molecular Formula | C19H31N3O |
| Molecular Weight | 317.48 g/mol |
| Exact Mass | 317.25 |
| IUPAC Name | N-[(4-aminocyclohexyl)methyl]-4-(2,6-dimethylmorpholin-4-yl)aniline |
| SMILES | CC1CN(c2ccc(NCC3CCC(N)CC3)cc2)CC(C)O1 |
| InChI | InChI=1S/C19H31N3O/c1-14-12-22(13-15(2)23-14)19-9-7-18(8-10-19)21-11-16-3-5-17(20)6-4-16/h7-10,14-17,21H,3-6,11-13,20H2,1-2H3 |
| InChIKey | YJBQFUFENJUVCN-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.48 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|