C20H32N4O3 — CID 60605719
1-[4-(2,6-dimethylmorpholin-4-yl)phenyl]-3-(3-morpholin-4-ylpropyl)urea (PubChem CID 60605719) has the molecular formula C20H32N4O3 and a molecular weight of 376.50 g/mol. Its IUPAC name is 1-[4-(2,6-dimethylmorpholin-4-yl)phenyl]-3-(3-morpholin-4-ylpropyl)urea.
| Compound Name | 1-[4-(2,6-dimethylmorpholin-4-yl)phenyl]-3-(3-morpholin-4-ylpropyl)urea |
|---|---|
| PubChem CID | 60605719 |
| Molecular Formula | C20H32N4O3 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.25 |
| IUPAC Name | 1-[4-(2,6-dimethylmorpholin-4-yl)phenyl]-3-(3-morpholin-4-ylpropyl)urea |
| SMILES | CC1CN(c2ccc(NC(=O)NCCCN3CCOCC3)cc2)CC(C)O1 |
| InChI | InChI=1S/C20H32N4O3/c1-16-14-24(15-17(2)27-16)19-6-4-18(5-7-19)22-20(25)21-8-3-9-23-10-12-26-13-11-23/h4-7,16-17H,3,8-15H2,1-2H3,(H2,21,22,25) |
| InChIKey | ZVYYOEXNXKFFIZ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|