C17H27N3O2 — CID 51334002
1-[3-(2,6-dimethylmorpholin-4-yl)propyl]-3-(4-methylphenyl)urea (PubChem CID 51334002) has the molecular formula C17H27N3O2 and a molecular weight of 305.42 g/mol. Its IUPAC name is 1-[3-(2,6-dimethylmorpholin-4-yl)propyl]-3-(4-methylphenyl)urea.
| Compound Name | 1-[3-(2,6-dimethylmorpholin-4-yl)propyl]-3-(4-methylphenyl)urea |
|---|---|
| PubChem CID | 51334002 |
| Molecular Formula | C17H27N3O2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | 1-[3-(2,6-dimethylmorpholin-4-yl)propyl]-3-(4-methylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)NCCCN2CC(C)OC(C)C2)cc1 |
| InChI | InChI=1S/C17H27N3O2/c1-13-5-7-16(8-6-13)19-17(21)18-9-4-10-20-11-14(2)22-15(3)12-20/h5-8,14-15H,4,9-12H2,1-3H3,(H2,18,19,21) |
| InChIKey | NKCAXELWMUEHFI-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|