C20H33N3O2S — CID 47024854
1-[3-(2,6-dimethylmorpholin-4-yl)propyl]-3-[2-(3,4-dimethylphenyl)sulfanylethyl]urea (PubChem CID 47024854) has the molecular formula C20H33N3O2S and a molecular weight of 379.57 g/mol. Its IUPAC name is 1-[3-(2,6-dimethylmorpholin-4-yl)propyl]-3-[2-(3,4-dimethylphenyl)sulfanylethyl]urea.
| Compound Name | 1-[3-(2,6-dimethylmorpholin-4-yl)propyl]-3-[2-(3,4-dimethylphenyl)sulfanylethyl]urea |
|---|---|
| PubChem CID | 47024854 |
| Molecular Formula | C20H33N3O2S |
| Molecular Weight | 379.57 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | 1-[3-(2,6-dimethylmorpholin-4-yl)propyl]-3-[2-(3,4-dimethylphenyl)sulfanylethyl]urea |
| SMILES | Cc1ccc(SCCNC(=O)NCCCN2CC(C)OC(C)C2)cc1C |
| InChI | InChI=1S/C20H33N3O2S/c1-15-6-7-19(12-16(15)2)26-11-9-22-20(24)21-8-5-10-23-13-17(3)25-18(4)14-23/h6-7,12,17-18H,5,8-11,13-14H2,1-4H3,(H2,21,22,24) |
| InChIKey | CRXWUZNJWFVFSE-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.57 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|