C18H27N3O3 — CID 2125723
2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-N-(4-morpholin-4-ylphenyl)acetamide (PubChem CID 2125723) has the molecular formula C18H27N3O3 and a molecular weight of 333.43 g/mol. Its IUPAC name is 2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-N-(4-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-N-(4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 2125723 |
| Molecular Formula | C18H27N3O3 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | 2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-N-(4-morpholin-4-ylphenyl)acetamide |
| SMILES | C[C@@H]1CN(CC(=O)Nc2ccc(N3CCOCC3)cc2)C[C@H](C)O1 |
| InChI | InChI=1S/C18H27N3O3/c1-14-11-20(12-15(2)24-14)13-18(22)19-16-3-5-17(6-4-16)21-7-9-23-10-8-21/h3-6,14-15H,7-13H2,1-2H3,(H,19,22)/t14-,15+ |
| InChIKey | XTRCYIVYYGOCHL-GASCZTMLSA-N |
| XLogP | 1.57 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|