C19H28N4O3 — CID 100895703
2-[(4aR,7aS)-4-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-N-(4-morpholin-4-ylphenyl)acetamide (PubChem CID 100895703) has the molecular formula C19H28N4O3 and a molecular weight of 360.46 g/mol. Its IUPAC name is 2-[(4aR,7aS)-4-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-N-(4-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-[(4aR,7aS)-4-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-N-(4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 100895703 |
| Molecular Formula | C19H28N4O3 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | 2-[(4aR,7aS)-4-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-N-(4-morpholin-4-ylphenyl)acetamide |
| SMILES | CN1CCO[C@H]2CN(CC(=O)Nc3ccc(N4CCOCC4)cc3)C[C@H]21 |
| InChI | InChI=1S/C19H28N4O3/c1-21-6-11-26-18-13-22(12-17(18)21)14-19(24)20-15-2-4-16(5-3-15)23-7-9-25-10-8-23/h2-5,17-18H,6-14H2,1H3,(H,20,24)/t17-,18+/m1/s1 |
| InChIKey | LVTKZRKCMDISSK-MSOLQXFVSA-N |
| XLogP | 0.48 |
| TPSA | 57.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|