C14H13NO2S — CID 28604312
4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)benzoic acid (PubChem CID 28604312) has the molecular formula C14H13NO2S and a molecular weight of 259.33 g/mol. Its IUPAC name is 4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)benzoic acid.
| Compound Name | 4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)benzoic acid |
|---|---|
| PubChem CID | 28604312 |
| Molecular Formula | C14H13NO2S |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | 4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)benzoic acid |
| SMILES | O=C(O)c1ccc(N2CCc3sccc3C2)cc1 |
| InChI | InChI=1S/C14H13NO2S/c16-14(17)10-1-3-12(4-2-10)15-7-5-13-11(9-15)6-8-18-13/h1-4,6,8H,5,7,9H2,(H,16,17) |
| InChIKey | DQHXFKXVUDIRAS-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |