About 4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)benzoic acid
4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)benzoic acid (PubChem CID 28604312) has the molecular formula C14H13NO2S
and a molecular weight of 259.33 g/mol. Its IUPAC name is 4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)benzoic acid.
Molecular Properties
| Compound Name | 4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)benzoic acid |
| PubChem CID | 28604312 |
| Molecular Formula | C14H13NO2S |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | 4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)benzoic acid |
| SMILES | O=C(O)c1ccc(N2CCc3sccc3C2)cc1 |
| InChI | InChI=1S/C14H13NO2S/c16-14(17)10-1-3-12(4-2-10)15-7-5-13-11(9-15)6-8-18-13/h1-4,6,8H,5,7,9H2,(H,16,17) |
| InChIKey | DQHXFKXVUDIRAS-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)benzoic acid?
The IUPAC name of 4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)benzoic acid (CID 28604312) is 4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)benzoic acid.
What is the SMILES notation for 4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)benzoic acid?
The canonical SMILES for 4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)benzoic acid is O=C(O)c1ccc(N2CCc3sccc3C2)cc1.
What is the InChIKey of 4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)benzoic acid?
The InChIKey is DQHXFKXVUDIRAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NO2S/c16-14(17)10-1-3-12(4-2-10)15-7-5-13-11(9-15)6-8-18-13/h1-4,6,8H,5,7,9H2,(H,16,17).
What are the key properties of 4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)benzoic acid?
4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)benzoic acid has a molecular weight of 259.33 g/mol, XLogP of 3.01, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)benzoic acid is sourced from PubChem (CID 28604312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).