C22H21F2N3OS — CID 60612089
1-[1-(3,4-difluorophenyl)ethyl]-3-[4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenyl]urea (PubChem CID 60612089) has the molecular formula C22H21F2N3OS and a molecular weight of 413.49 g/mol. Its IUPAC name is 1-[1-(3,4-difluorophenyl)ethyl]-3-[4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenyl]urea.
| Compound Name | 1-[1-(3,4-difluorophenyl)ethyl]-3-[4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenyl]urea |
|---|---|
| PubChem CID | 60612089 |
| Molecular Formula | C22H21F2N3OS |
| Molecular Weight | 413.49 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | 1-[1-(3,4-difluorophenyl)ethyl]-3-[4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)phenyl]urea |
| SMILES | CC(NC(=O)Nc1ccc(N2CCc3sccc3C2)cc1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C22H21F2N3OS/c1-14(15-2-7-19(23)20(24)12-15)25-22(28)26-17-3-5-18(6-4-17)27-10-8-21-16(13-27)9-11-29-21/h2-7,9,11-12,14H,8,10,13H2,1H3,(H2,25,26,28) |
| InChIKey | FTVLVJVJRCACKT-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.49 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|