C20H24F2N4O — CID 71886613
1-(2,6-difluorophenyl)-3-[1-[4-(4-methylpiperazin-1-yl)phenyl]ethyl]urea (PubChem CID 71886613) has the molecular formula C20H24F2N4O and a molecular weight of 374.44 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-3-[1-[4-(4-methylpiperazin-1-yl)phenyl]ethyl]urea.
| Compound Name | 1-(2,6-difluorophenyl)-3-[1-[4-(4-methylpiperazin-1-yl)phenyl]ethyl]urea |
|---|---|
| PubChem CID | 71886613 |
| Molecular Formula | C20H24F2N4O |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | 1-(2,6-difluorophenyl)-3-[1-[4-(4-methylpiperazin-1-yl)phenyl]ethyl]urea |
| SMILES | CC(NC(=O)Nc1c(F)cccc1F)c1ccc(N2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C20H24F2N4O/c1-14(23-20(27)24-19-17(21)4-3-5-18(19)22)15-6-8-16(9-7-15)26-12-10-25(2)11-13-26/h3-9,14H,10-13H2,1-2H3,(H2,23,24,27) |
| InChIKey | ZPMFHAITEKEFDQ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|