C19H28N4O2 — CID 75462150
1-methyl-N-[1-[4-(4-methylpiperazin-1-yl)phenyl]ethyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 75462150) has the molecular formula C19H28N4O2 and a molecular weight of 344.46 g/mol. Its IUPAC name is 1-methyl-N-[1-[4-(4-methylpiperazin-1-yl)phenyl]ethyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-methyl-N-[1-[4-(4-methylpiperazin-1-yl)phenyl]ethyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 75462150 |
| Molecular Formula | C19H28N4O2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | 1-methyl-N-[1-[4-(4-methylpiperazin-1-yl)phenyl]ethyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | CC(NC(=O)C1CC(=O)N(C)C1)c1ccc(N2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C19H28N4O2/c1-14(20-19(25)16-12-18(24)22(3)13-16)15-4-6-17(7-5-15)23-10-8-21(2)9-11-23/h4-7,14,16H,8-13H2,1-3H3,(H,20,25) |
| InChIKey | ZEMIPNFVDDVOSI-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|