C27H33F3N4O2 — CID 163722787
1-ethyl-5-oxo-N-[1-[4-[4-[4-(trifluoromethyl)piperidin-1-yl]anilino]phenyl]ethyl]pyrrolidine-3-carboxamide (PubChem CID 163722787) has the molecular formula C27H33F3N4O2 and a molecular weight of 502.58 g/mol. Its IUPAC name is 1-ethyl-5-oxo-N-[1-[4-[4-[4-(trifluoromethyl)piperidin-1-yl]anilino]phenyl]ethyl]pyrrolidine-3-carboxamide.
| Compound Name | 1-ethyl-5-oxo-N-[1-[4-[4-[4-(trifluoromethyl)piperidin-1-yl]anilino]phenyl]ethyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 163722787 |
| Molecular Formula | C27H33F3N4O2 |
| Molecular Weight | 502.58 g/mol |
| Exact Mass | 502.26 |
| IUPAC Name | 1-ethyl-5-oxo-N-[1-[4-[4-[4-(trifluoromethyl)piperidin-1-yl]anilino]phenyl]ethyl]pyrrolidine-3-carboxamide |
| SMILES | CCN1CC(C(=O)NC(C)c2ccc(Nc3ccc(N4CCC(C(F)(F)F)CC4)cc3)cc2)CC1=O |
| InChI | InChI=1S/C27H33F3N4O2/c1-3-33-17-20(16-25(33)35)26(36)31-18(2)19-4-6-22(7-5-19)32-23-8-10-24(11-9-23)34-14-12-21(13-15-34)27(28,29)30/h4-11,18,20-21,32H,3,12-17H2,1-2H3,(H,31,36) |
| InChIKey | KSZYIMRNLYNYEN-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.58 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|