C24H29F3N4O — CID 166062233
1-[[4-[4-[4-(trifluoromethyl)piperidin-1-yl]anilino]phenyl]methyl]pyrrolidine-3-carboxamide (PubChem CID 166062233) has the molecular formula C24H29F3N4O and a molecular weight of 446.52 g/mol. Its IUPAC name is 1-[[4-[4-[4-(trifluoromethyl)piperidin-1-yl]anilino]phenyl]methyl]pyrrolidine-3-carboxamide.
| Compound Name | 1-[[4-[4-[4-(trifluoromethyl)piperidin-1-yl]anilino]phenyl]methyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 166062233 |
| Molecular Formula | C24H29F3N4O |
| Molecular Weight | 446.52 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | 1-[[4-[4-[4-(trifluoromethyl)piperidin-1-yl]anilino]phenyl]methyl]pyrrolidine-3-carboxamide |
| SMILES | NC(=O)C1CCN(Cc2ccc(Nc3ccc(N4CCC(C(F)(F)F)CC4)cc3)cc2)C1 |
| InChI | InChI=1S/C24H29F3N4O/c25-24(26,27)19-10-13-31(14-11-19)22-7-5-21(6-8-22)29-20-3-1-17(2-4-20)15-30-12-9-18(16-30)23(28)32/h1-8,18-19,29H,9-16H2,(H2,28,32) |
| InChIKey | CYOWSDWIUHOOPY-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.52 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|