C16H24N4O2 — CID 119872163
1-[[4-(3-aminopropanoylamino)phenyl]methyl]piperidine-3-carboxamide (PubChem CID 119872163) has the molecular formula C16H24N4O2 and a molecular weight of 304.39 g/mol. Its IUPAC name is 1-[[4-(3-aminopropanoylamino)phenyl]methyl]piperidine-3-carboxamide.
| Compound Name | 1-[[4-(3-aminopropanoylamino)phenyl]methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 119872163 |
| Molecular Formula | C16H24N4O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | 1-[[4-(3-aminopropanoylamino)phenyl]methyl]piperidine-3-carboxamide |
| SMILES | NCCC(=O)Nc1ccc(CN2CCCC(C(N)=O)C2)cc1 |
| InChI | InChI=1S/C16H24N4O2/c17-8-7-15(21)19-14-5-3-12(4-6-14)10-20-9-1-2-13(11-20)16(18)22/h3-6,13H,1-2,7-11,17H2,(H2,18,22)(H,19,21) |
| InChIKey | HDRUNKKFSSFQIY-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |