C27H35N3O3 — CID 56509678
1-[[4-[3-(3-cyclopentyloxyphenyl)propanoylamino]phenyl]methyl]piperidine-3-carboxamide (PubChem CID 56509678) has the molecular formula C27H35N3O3 and a molecular weight of 449.60 g/mol. Its IUPAC name is 1-[[4-[3-(3-cyclopentyloxyphenyl)propanoylamino]phenyl]methyl]piperidine-3-carboxamide.
| Compound Name | 1-[[4-[3-(3-cyclopentyloxyphenyl)propanoylamino]phenyl]methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 56509678 |
| Molecular Formula | C27H35N3O3 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.27 |
| IUPAC Name | 1-[[4-[3-(3-cyclopentyloxyphenyl)propanoylamino]phenyl]methyl]piperidine-3-carboxamide |
| SMILES | NC(=O)C1CCCN(Cc2ccc(NC(=O)CCc3cccc(OC4CCCC4)c3)cc2)C1 |
| InChI | InChI=1S/C27H35N3O3/c28-27(32)22-6-4-16-30(19-22)18-21-10-13-23(14-11-21)29-26(31)15-12-20-5-3-9-25(17-20)33-24-7-1-2-8-24/h3,5,9-11,13-14,17,22,24H,1-2,4,6-8,12,15-16,18-19H2,(H2,28,32)(H,29,31) |
| InChIKey | FUPNNBXZQNGOEP-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |