C24H31N5O3 — CID 56509542
1-[[4-[[4-(propan-2-ylcarbamoylamino)benzoyl]amino]phenyl]methyl]piperidine-3-carboxamide (PubChem CID 56509542) has the molecular formula C24H31N5O3 and a molecular weight of 437.54 g/mol. Its IUPAC name is 1-[[4-[[4-(propan-2-ylcarbamoylamino)benzoyl]amino]phenyl]methyl]piperidine-3-carboxamide.
| Compound Name | 1-[[4-[[4-(propan-2-ylcarbamoylamino)benzoyl]amino]phenyl]methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 56509542 |
| Molecular Formula | C24H31N5O3 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.24 |
| IUPAC Name | 1-[[4-[[4-(propan-2-ylcarbamoylamino)benzoyl]amino]phenyl]methyl]piperidine-3-carboxamide |
| SMILES | CC(C)NC(=O)Nc1ccc(C(=O)Nc2ccc(CN3CCCC(C(N)=O)C3)cc2)cc1 |
| InChI | InChI=1S/C24H31N5O3/c1-16(2)26-24(32)28-21-11-7-18(8-12-21)23(31)27-20-9-5-17(6-10-20)14-29-13-3-4-19(15-29)22(25)30/h5-12,16,19H,3-4,13-15H2,1-2H3,(H2,25,30)(H,27,31)(H2,26,28,32) |
| InChIKey | OPMPLGSVCHCFFE-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 116.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |