C23H29F3N4O — CID 166062587
4-amino-N-[[4-[4-[4-(trifluoromethyl)piperidin-1-yl]anilino]phenyl]methyl]butanamide (PubChem CID 166062587) has the molecular formula C23H29F3N4O and a molecular weight of 434.51 g/mol. Its IUPAC name is 4-amino-N-[[4-[4-[4-(trifluoromethyl)piperidin-1-yl]anilino]phenyl]methyl]butanamide.
| Compound Name | 4-amino-N-[[4-[4-[4-(trifluoromethyl)piperidin-1-yl]anilino]phenyl]methyl]butanamide |
|---|---|
| PubChem CID | 166062587 |
| Molecular Formula | C23H29F3N4O |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | 4-amino-N-[[4-[4-[4-(trifluoromethyl)piperidin-1-yl]anilino]phenyl]methyl]butanamide |
| SMILES | NCCCC(=O)NCc1ccc(Nc2ccc(N3CCC(C(F)(F)F)CC3)cc2)cc1 |
| InChI | InChI=1S/C23H29F3N4O/c24-23(25,26)18-11-14-30(15-12-18)21-9-7-20(8-10-21)29-19-5-3-17(4-6-19)16-28-22(31)2-1-13-27/h3-10,18,29H,1-2,11-16,27H2,(H,28,31) |
| InChIKey | XCAULLKTFTZVTA-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|