C24H27F3N4O2 — CID 168752895
2-oxo-N-[[3-[4-[4-(trifluoromethyl)piperidin-1-yl]anilino]phenyl]methyl]pyrrolidine-3-carboxamide (PubChem CID 168752895) has the molecular formula C24H27F3N4O2 and a molecular weight of 460.50 g/mol. Its IUPAC name is 2-oxo-N-[[3-[4-[4-(trifluoromethyl)piperidin-1-yl]anilino]phenyl]methyl]pyrrolidine-3-carboxamide.
| Compound Name | 2-oxo-N-[[3-[4-[4-(trifluoromethyl)piperidin-1-yl]anilino]phenyl]methyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 168752895 |
| Molecular Formula | C24H27F3N4O2 |
| Molecular Weight | 460.50 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | 2-oxo-N-[[3-[4-[4-(trifluoromethyl)piperidin-1-yl]anilino]phenyl]methyl]pyrrolidine-3-carboxamide |
| SMILES | O=C1NCCC1C(=O)NCc1cccc(Nc2ccc(N3CCC(C(F)(F)F)CC3)cc2)c1 |
| InChI | InChI=1S/C24H27F3N4O2/c25-24(26,27)17-9-12-31(13-10-17)20-6-4-18(5-7-20)30-19-3-1-2-16(14-19)15-29-23(33)21-8-11-28-22(21)32/h1-7,14,17,21,30H,8-13,15H2,(H,28,32)(H,29,33) |
| InChIKey | RUSUOBNWDLTAFK-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.50 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|