C20H20F3N3O — CID 167300425
5-[4-[4-(trifluoromethyl)piperidin-1-yl]anilino]-2,3-dihydroisoindol-1-one (PubChem CID 167300425) has the molecular formula C20H20F3N3O and a molecular weight of 375.39 g/mol. Its IUPAC name is 5-[4-[4-(trifluoromethyl)piperidin-1-yl]anilino]-2,3-dihydroisoindol-1-one.
| Compound Name | 5-[4-[4-(trifluoromethyl)piperidin-1-yl]anilino]-2,3-dihydroisoindol-1-one |
|---|---|
| PubChem CID | 167300425 |
| Molecular Formula | C20H20F3N3O |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 5-[4-[4-(trifluoromethyl)piperidin-1-yl]anilino]-2,3-dihydroisoindol-1-one |
| SMILES | O=C1NCc2cc(Nc3ccc(N4CCC(C(F)(F)F)CC4)cc3)ccc21 |
| InChI | InChI=1S/C20H20F3N3O/c21-20(22,23)14-7-9-26(10-8-14)17-4-1-15(2-5-17)25-16-3-6-18-13(11-16)12-24-19(18)27/h1-6,11,14,25H,7-10,12H2,(H,24,27) |
| InChIKey | LOVSJJQIDJUBKS-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|