C22H24F3N3O — CID 167300242
1-methyl-6-[4-[4-(trifluoromethyl)piperidin-1-yl]anilino]-3,4-dihydroquinolin-2-one (PubChem CID 167300242) has the molecular formula C22H24F3N3O and a molecular weight of 403.45 g/mol. Its IUPAC name is 1-methyl-6-[4-[4-(trifluoromethyl)piperidin-1-yl]anilino]-3,4-dihydroquinolin-2-one.
| Compound Name | 1-methyl-6-[4-[4-(trifluoromethyl)piperidin-1-yl]anilino]-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 167300242 |
| Molecular Formula | C22H24F3N3O |
| Molecular Weight | 403.45 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | 1-methyl-6-[4-[4-(trifluoromethyl)piperidin-1-yl]anilino]-3,4-dihydroquinolin-2-one |
| SMILES | CN1C(=O)CCc2cc(Nc3ccc(N4CCC(C(F)(F)F)CC4)cc3)ccc21 |
| InChI | InChI=1S/C22H24F3N3O/c1-27-20-8-5-18(14-15(20)2-9-21(27)29)26-17-3-6-19(7-4-17)28-12-10-16(11-13-28)22(23,24)25/h3-8,14,16,26H,2,9-13H2,1H3 |
| InChIKey | KDVRYIBHBZRWFU-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.45 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|