C20H24N4O2 — CID 22124813
7-[4-(4-hydroxypiperidin-1-yl)anilino]-1-methyl-3,4-dihydro-1,6-naphthyridin-2-one (PubChem CID 22124813) has the molecular formula C20H24N4O2 and a molecular weight of 352.44 g/mol. Its IUPAC name is 7-[4-(4-hydroxypiperidin-1-yl)anilino]-1-methyl-3,4-dihydro-1,6-naphthyridin-2-one.
| Compound Name | 7-[4-(4-hydroxypiperidin-1-yl)anilino]-1-methyl-3,4-dihydro-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 22124813 |
| Molecular Formula | C20H24N4O2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | 7-[4-(4-hydroxypiperidin-1-yl)anilino]-1-methyl-3,4-dihydro-1,6-naphthyridin-2-one |
| SMILES | CN1C(=O)CCc2cnc(Nc3ccc(N4CCC(O)CC4)cc3)cc21 |
| InChI | InChI=1S/C20H24N4O2/c1-23-18-12-19(21-13-14(18)2-7-20(23)26)22-15-3-5-16(6-4-15)24-10-8-17(25)9-11-24/h3-6,12-13,17,25H,2,7-11H2,1H3,(H,21,22) |
| InChIKey | KUHVVANJAARADZ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 68.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|