C24H27FN4O2 — CID 22124688
1-cyclopentyl-3-fluoro-7-[4-(4-hydroxypiperidin-1-yl)anilino]-1,6-naphthyridin-2-one (PubChem CID 22124688) has the molecular formula C24H27FN4O2 and a molecular weight of 422.50 g/mol. Its IUPAC name is 1-cyclopentyl-3-fluoro-7-[4-(4-hydroxypiperidin-1-yl)anilino]-1,6-naphthyridin-2-one.
| Compound Name | 1-cyclopentyl-3-fluoro-7-[4-(4-hydroxypiperidin-1-yl)anilino]-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 22124688 |
| Molecular Formula | C24H27FN4O2 |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | 1-cyclopentyl-3-fluoro-7-[4-(4-hydroxypiperidin-1-yl)anilino]-1,6-naphthyridin-2-one |
| SMILES | O=c1c(F)cc2cnc(Nc3ccc(N4CCC(O)CC4)cc3)cc2n1C1CCCC1 |
| InChI | InChI=1S/C24H27FN4O2/c25-21-13-16-15-26-23(14-22(16)29(24(21)31)19-3-1-2-4-19)27-17-5-7-18(8-6-17)28-11-9-20(30)10-12-28/h5-8,13-15,19-20,30H,1-4,9-12H2,(H,26,27) |
| InChIKey | RCTMKUMGLSHSKW-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|