C23H26N4O2 — CID 46701508
1-cyclopentyl-7-(4-morpholin-4-ylanilino)-1,6-naphthyridin-2-one (PubChem CID 46701508) has the molecular formula C23H26N4O2 and a molecular weight of 390.49 g/mol. Its IUPAC name is 1-cyclopentyl-7-(4-morpholin-4-ylanilino)-1,6-naphthyridin-2-one.
| Compound Name | 1-cyclopentyl-7-(4-morpholin-4-ylanilino)-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 46701508 |
| Molecular Formula | C23H26N4O2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | 1-cyclopentyl-7-(4-morpholin-4-ylanilino)-1,6-naphthyridin-2-one |
| SMILES | O=c1ccc2cnc(Nc3ccc(N4CCOCC4)cc3)cc2n1C1CCCC1 |
| InChI | InChI=1S/C23H26N4O2/c28-23-10-5-17-16-24-22(15-21(17)27(23)20-3-1-2-4-20)25-18-6-8-19(9-7-18)26-11-13-29-14-12-26/h5-10,15-16,20H,1-4,11-14H2,(H,24,25) |
| InChIKey | VARMIONXVVBZMY-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|