C20H22N4O — CID 22124727
1-methyl-7-(4-piperidin-1-ylanilino)-1,6-naphthyridin-2-one (PubChem CID 22124727) has the molecular formula C20H22N4O and a molecular weight of 334.42 g/mol. Its IUPAC name is 1-methyl-7-(4-piperidin-1-ylanilino)-1,6-naphthyridin-2-one.
| Compound Name | 1-methyl-7-(4-piperidin-1-ylanilino)-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 22124727 |
| Molecular Formula | C20H22N4O |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | 1-methyl-7-(4-piperidin-1-ylanilino)-1,6-naphthyridin-2-one |
| SMILES | Cn1c(=O)ccc2cnc(Nc3ccc(N4CCCCC4)cc3)cc21 |
| InChI | InChI=1S/C20H22N4O/c1-23-18-13-19(21-14-15(18)5-10-20(23)25)22-16-6-8-17(9-7-16)24-11-3-2-4-12-24/h5-10,13-14H,2-4,11-12H2,1H3,(H,21,22) |
| InChIKey | BEZNNJBSFHIOOA-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|