C25H22Cl2N4O3S — CID 167119046
3-(2,6-dichlorophenyl)-7-[4-(1,1-dioxo-1,4-thiazinan-4-yl)anilino]-1-methyl-1,6-naphthyridin-2-one (PubChem CID 167119046) has the molecular formula C25H22Cl2N4O3S and a molecular weight of 529.45 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-7-[4-(1,1-dioxo-1,4-thiazinan-4-yl)anilino]-1-methyl-1,6-naphthyridin-2-one.
| Compound Name | 3-(2,6-dichlorophenyl)-7-[4-(1,1-dioxo-1,4-thiazinan-4-yl)anilino]-1-methyl-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 167119046 |
| Molecular Formula | C25H22Cl2N4O3S |
| Molecular Weight | 529.45 g/mol |
| Exact Mass | 528.08 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-7-[4-(1,1-dioxo-1,4-thiazinan-4-yl)anilino]-1-methyl-1,6-naphthyridin-2-one |
| SMILES | Cn1c(=O)c(-c2c(Cl)cccc2Cl)cc2cnc(Nc3ccc(N4CCS(=O)(=O)CC4)cc3)cc21 |
| InChI | InChI=1S/C25H22Cl2N4O3S/c1-30-22-14-23(29-17-5-7-18(8-6-17)31-9-11-35(33,34)12-10-31)28-15-16(22)13-19(25(30)32)24-20(26)3-2-4-21(24)27/h2-8,13-15H,9-12H2,1H3,(H,28,29) |
| InChIKey | RDQKYOKSVKZLOU-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.45 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|