C23H27Cl2N5O — CID 5328707
3-(2,6-dichlorophenyl)-1-methyl-7-[3-(4-methylpiperazin-1-yl)propylamino]-1,6-naphthyridin-2-one (PubChem CID 5328707) has the molecular formula C23H27Cl2N5O and a molecular weight of 460.41 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-1-methyl-7-[3-(4-methylpiperazin-1-yl)propylamino]-1,6-naphthyridin-2-one.
| Compound Name | 3-(2,6-dichlorophenyl)-1-methyl-7-[3-(4-methylpiperazin-1-yl)propylamino]-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 5328707 |
| Molecular Formula | C23H27Cl2N5O |
| Molecular Weight | 460.41 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-1-methyl-7-[3-(4-methylpiperazin-1-yl)propylamino]-1,6-naphthyridin-2-one |
| SMILES | CN1CCN(CCCNc2cc3c(cn2)cc(-c2c(Cl)cccc2Cl)c(=O)n3C)CC1 |
| InChI | InChI=1S/C23H27Cl2N5O/c1-28-9-11-30(12-10-28)8-4-7-26-21-14-20-16(15-27-21)13-17(23(31)29(20)2)22-18(24)5-3-6-19(22)25/h3,5-6,13-15H,4,7-12H2,1-2H3,(H,26,27) |
| InChIKey | QHXLYXAXXJZXCK-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.41 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|