C21H26N6O — CID 70209396
7-[4-[4-(dimethylamino)piperidin-1-yl]anilino]-1-methylpyrido[4,3-d]pyrimidin-2-one (PubChem CID 70209396) has the molecular formula C21H26N6O and a molecular weight of 378.48 g/mol. Its IUPAC name is 7-[4-[4-(dimethylamino)piperidin-1-yl]anilino]-1-methylpyrido[4,3-d]pyrimidin-2-one.
| Compound Name | 7-[4-[4-(dimethylamino)piperidin-1-yl]anilino]-1-methylpyrido[4,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 70209396 |
| Molecular Formula | C21H26N6O |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | 7-[4-[4-(dimethylamino)piperidin-1-yl]anilino]-1-methylpyrido[4,3-d]pyrimidin-2-one |
| SMILES | CN(C)C1CCN(c2ccc(Nc3cc4c(cn3)cnc(=O)n4C)cc2)CC1 |
| InChI | InChI=1S/C21H26N6O/c1-25(2)17-8-10-27(11-9-17)18-6-4-16(5-7-18)24-20-12-19-15(13-22-20)14-23-21(28)26(19)3/h4-7,12-14,17H,8-11H2,1-3H3,(H,22,24) |
| InChIKey | NQCACCCFJVFCFY-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|