C23H27N5O — CID 46701507
1-cyclobutyl-7-[4-(4-methylpiperazin-1-yl)anilino]-1,6-naphthyridin-2-one (PubChem CID 46701507) has the molecular formula C23H27N5O and a molecular weight of 389.50 g/mol. Its IUPAC name is 1-cyclobutyl-7-[4-(4-methylpiperazin-1-yl)anilino]-1,6-naphthyridin-2-one.
| Compound Name | 1-cyclobutyl-7-[4-(4-methylpiperazin-1-yl)anilino]-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 46701507 |
| Molecular Formula | C23H27N5O |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | 1-cyclobutyl-7-[4-(4-methylpiperazin-1-yl)anilino]-1,6-naphthyridin-2-one |
| SMILES | CN1CCN(c2ccc(Nc3cc4c(ccc(=O)n4C4CCC4)cn3)cc2)CC1 |
| InChI | InChI=1S/C23H27N5O/c1-26-11-13-27(14-12-26)19-8-6-18(7-9-19)25-22-15-21-17(16-24-22)5-10-23(29)28(21)20-3-2-4-20/h5-10,15-16,20H,2-4,11-14H2,1H3,(H,24,25) |
| InChIKey | KSPUWQWJOOAMLC-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|