C24H26N6O — CID 155458659
1-cyclopentyl-2-oxo-7-(4-piperazin-1-ylanilino)-1,6-naphthyridine-3-carbonitrile (PubChem CID 155458659) has the molecular formula C24H26N6O and a molecular weight of 414.51 g/mol. Its IUPAC name is 1-cyclopentyl-2-oxo-7-(4-piperazin-1-ylanilino)-1,6-naphthyridine-3-carbonitrile.
| Compound Name | 1-cyclopentyl-2-oxo-7-(4-piperazin-1-ylanilino)-1,6-naphthyridine-3-carbonitrile |
|---|---|
| PubChem CID | 155458659 |
| Molecular Formula | C24H26N6O |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | 1-cyclopentyl-2-oxo-7-(4-piperazin-1-ylanilino)-1,6-naphthyridine-3-carbonitrile |
| SMILES | N#Cc1cc2cnc(Nc3ccc(N4CCNCC4)cc3)cc2n(C2CCCC2)c1=O |
| InChI | InChI=1S/C24H26N6O/c25-15-17-13-18-16-27-23(14-22(18)30(24(17)31)21-3-1-2-4-21)28-19-5-7-20(8-6-19)29-11-9-26-10-12-29/h5-8,13-14,16,21,26H,1-4,9-12H2,(H,27,28) |
| InChIKey | BZSYKRGIBJZDER-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 85.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|