C25H29N9O — CID 10183766
1-[6-cyano-2-(4-piperazin-1-ylanilino)pyrido[2,3-d]pyrimidin-7-yl]-3-cyclohexylurea (PubChem CID 10183766) has the molecular formula C25H29N9O and a molecular weight of 471.57 g/mol. Its IUPAC name is 1-[6-cyano-2-(4-piperazin-1-ylanilino)pyrido[2,3-d]pyrimidin-7-yl]-3-cyclohexylurea.
| Compound Name | 1-[6-cyano-2-(4-piperazin-1-ylanilino)pyrido[2,3-d]pyrimidin-7-yl]-3-cyclohexylurea |
|---|---|
| PubChem CID | 10183766 |
| Molecular Formula | C25H29N9O |
| Molecular Weight | 471.57 g/mol |
| Exact Mass | 471.25 |
| IUPAC Name | 1-[6-cyano-2-(4-piperazin-1-ylanilino)pyrido[2,3-d]pyrimidin-7-yl]-3-cyclohexylurea |
| SMILES | N#Cc1cc2cnc(Nc3ccc(N4CCNCC4)cc3)nc2nc1NC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C25H29N9O/c26-15-17-14-18-16-28-24(29-20-6-8-21(9-7-20)34-12-10-27-11-13-34)32-23(18)31-22(17)33-25(35)30-19-4-2-1-3-5-19/h6-9,14,16,19,27H,1-5,10-13H2,(H3,28,29,30,31,32,33,35) |
| InChIKey | XSDIGEOCQDHWOK-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 130.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.57 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|