C22H29N5O — CID 109298915
N-cyclohexyl-2-(4-piperidin-1-ylanilino)pyrimidine-4-carboxamide (PubChem CID 109298915) has the molecular formula C22H29N5O and a molecular weight of 379.51 g/mol. Its IUPAC name is N-cyclohexyl-2-(4-piperidin-1-ylanilino)pyrimidine-4-carboxamide.
| Compound Name | N-cyclohexyl-2-(4-piperidin-1-ylanilino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109298915 |
| Molecular Formula | C22H29N5O |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.24 |
| IUPAC Name | N-cyclohexyl-2-(4-piperidin-1-ylanilino)pyrimidine-4-carboxamide |
| SMILES | O=C(NC1CCCCC1)c1ccnc(Nc2ccc(N3CCCCC3)cc2)n1 |
| InChI | InChI=1S/C22H29N5O/c28-21(24-17-7-3-1-4-8-17)20-13-14-23-22(26-20)25-18-9-11-19(12-10-18)27-15-5-2-6-16-27/h9-14,17H,1-8,15-16H2,(H,24,28)(H,23,25,26) |
| InChIKey | NQQJBEWTPPESJB-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|