C19H25N5O — CID 109297037
N-(2-methylpropyl)-2-(4-pyrrolidin-1-ylanilino)pyrimidine-4-carboxamide (PubChem CID 109297037) has the molecular formula C19H25N5O and a molecular weight of 339.44 g/mol. Its IUPAC name is N-(2-methylpropyl)-2-(4-pyrrolidin-1-ylanilino)pyrimidine-4-carboxamide.
| Compound Name | N-(2-methylpropyl)-2-(4-pyrrolidin-1-ylanilino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109297037 |
| Molecular Formula | C19H25N5O |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.21 |
| IUPAC Name | N-(2-methylpropyl)-2-(4-pyrrolidin-1-ylanilino)pyrimidine-4-carboxamide |
| SMILES | CC(C)CNC(=O)c1ccnc(Nc2ccc(N3CCCC3)cc2)n1 |
| InChI | InChI=1S/C19H25N5O/c1-14(2)13-21-18(25)17-9-10-20-19(23-17)22-15-5-7-16(8-6-15)24-11-3-4-12-24/h5-10,14H,3-4,11-13H2,1-2H3,(H,21,25)(H,20,22,23) |
| InChIKey | MDFZPTPOFVOLIG-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|