C20H25N5O2 — CID 109300656
morpholin-4-yl-[2-(4-piperidin-1-ylanilino)pyrimidin-4-yl]methanone (PubChem CID 109300656) has the molecular formula C20H25N5O2 and a molecular weight of 367.45 g/mol. Its IUPAC name is morpholin-4-yl-[2-(4-piperidin-1-ylanilino)pyrimidin-4-yl]methanone.
| Compound Name | morpholin-4-yl-[2-(4-piperidin-1-ylanilino)pyrimidin-4-yl]methanone |
|---|---|
| PubChem CID | 109300656 |
| Molecular Formula | C20H25N5O2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | morpholin-4-yl-[2-(4-piperidin-1-ylanilino)pyrimidin-4-yl]methanone |
| SMILES | O=C(c1ccnc(Nc2ccc(N3CCCCC3)cc2)n1)N1CCOCC1 |
| InChI | InChI=1S/C20H25N5O2/c26-19(25-12-14-27-15-13-25)18-8-9-21-20(23-18)22-16-4-6-17(7-5-16)24-10-2-1-3-11-24/h4-9H,1-3,10-15H2,(H,21,22,23) |
| InChIKey | AXROWNUBGYKAII-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|