C22H27FN8O — CID 10138032
1-tert-butyl-3-[6-fluoro-2-(4-piperazin-1-ylanilino)pyrido[2,3-d]pyrimidin-7-yl]urea (PubChem CID 10138032) has the molecular formula C22H27FN8O and a molecular weight of 438.51 g/mol. Its IUPAC name is 1-tert-butyl-3-[6-fluoro-2-(4-piperazin-1-ylanilino)pyrido[2,3-d]pyrimidin-7-yl]urea.
| Compound Name | 1-tert-butyl-3-[6-fluoro-2-(4-piperazin-1-ylanilino)pyrido[2,3-d]pyrimidin-7-yl]urea |
|---|---|
| PubChem CID | 10138032 |
| Molecular Formula | C22H27FN8O |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | 1-tert-butyl-3-[6-fluoro-2-(4-piperazin-1-ylanilino)pyrido[2,3-d]pyrimidin-7-yl]urea |
| SMILES | CC(C)(C)NC(=O)Nc1nc2nc(Nc3ccc(N4CCNCC4)cc3)ncc2cc1F |
| InChI | InChI=1S/C22H27FN8O/c1-22(2,3)30-21(32)29-19-17(23)12-14-13-25-20(28-18(14)27-19)26-15-4-6-16(7-5-15)31-10-8-24-9-11-31/h4-7,12-13,24H,8-11H2,1-3H3,(H3,25,26,27,28,29,30,32) |
| InChIKey | FTPGODXQOCTHDX-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 107.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|