C21H21FN6O2 — CID 175965161
2-[[5-fluoro-4-(4-piperazin-1-ylanilino)pyrimidin-2-yl]amino]benzoic acid (PubChem CID 175965161) has the molecular formula C21H21FN6O2 and a molecular weight of 408.44 g/mol. Its IUPAC name is 2-[[5-fluoro-4-(4-piperazin-1-ylanilino)pyrimidin-2-yl]amino]benzoic acid.
| Compound Name | 2-[[5-fluoro-4-(4-piperazin-1-ylanilino)pyrimidin-2-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 175965161 |
| Molecular Formula | C21H21FN6O2 |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 2-[[5-fluoro-4-(4-piperazin-1-ylanilino)pyrimidin-2-yl]amino]benzoic acid |
| SMILES | O=C(O)c1ccccc1Nc1ncc(F)c(Nc2ccc(N3CCNCC3)cc2)n1 |
| InChI | InChI=1S/C21H21FN6O2/c22-17-13-24-21(26-18-4-2-1-3-16(18)20(29)30)27-19(17)25-14-5-7-15(8-6-14)28-11-9-23-10-12-28/h1-8,13,23H,9-12H2,(H,29,30)(H2,24,25,26,27) |
| InChIKey | FKLCTKOUZFAZOF-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 102.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|