C24H19FN4O3 — CID 163212180
methyl 2-[[5-fluoro-2-(4-phenoxyanilino)pyrimidin-4-yl]amino]benzoate (PubChem CID 163212180) has the molecular formula C24H19FN4O3 and a molecular weight of 430.44 g/mol. Its IUPAC name is methyl 2-[[5-fluoro-2-(4-phenoxyanilino)pyrimidin-4-yl]amino]benzoate.
| Compound Name | methyl 2-[[5-fluoro-2-(4-phenoxyanilino)pyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 163212180 |
| Molecular Formula | C24H19FN4O3 |
| Molecular Weight | 430.44 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | methyl 2-[[5-fluoro-2-(4-phenoxyanilino)pyrimidin-4-yl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1Nc1nc(Nc2ccc(Oc3ccccc3)cc2)ncc1F |
| InChI | InChI=1S/C24H19FN4O3/c1-31-23(30)19-9-5-6-10-21(19)28-22-20(25)15-26-24(29-22)27-16-11-13-18(14-12-16)32-17-7-3-2-4-8-17/h2-15H,1H3,(H2,26,27,28,29) |
| InChIKey | LDKLSKBPMHCBIU-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.44 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |