C20H17FN4O6 — CID 118729094
2-[4-[[2-[4-(carboxymethoxy)anilino]-5-fluoropyrimidin-4-yl]amino]phenoxy]acetic acid (PubChem CID 118729094) has the molecular formula C20H17FN4O6 and a molecular weight of 428.38 g/mol. Its IUPAC name is 2-[4-[[2-[4-(carboxymethoxy)anilino]-5-fluoropyrimidin-4-yl]amino]phenoxy]acetic acid.
| Compound Name | 2-[4-[[2-[4-(carboxymethoxy)anilino]-5-fluoropyrimidin-4-yl]amino]phenoxy]acetic acid |
|---|---|
| PubChem CID | 118729094 |
| Molecular Formula | C20H17FN4O6 |
| Molecular Weight | 428.38 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | 2-[4-[[2-[4-(carboxymethoxy)anilino]-5-fluoropyrimidin-4-yl]amino]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(Nc2ncc(F)c(Nc3ccc(OCC(=O)O)cc3)n2)cc1 |
| InChI | InChI=1S/C20H17FN4O6/c21-16-9-22-20(24-13-3-7-15(8-4-13)31-11-18(28)29)25-19(16)23-12-1-5-14(6-2-12)30-10-17(26)27/h1-9H,10-11H2,(H,26,27)(H,28,29)(H2,22,23,24,25) |
| InChIKey | MAACPYOAIQQPFU-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 142.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.38 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |