C19H18FN5O4 — CID 174489135
[4-[[5-fluoro-4-(3-hydroxyanilino)pyrimidin-2-yl]amino]phenoxy]methyl N-methylcarbamate (PubChem CID 174489135) has the molecular formula C19H18FN5O4 and a molecular weight of 399.38 g/mol. Its IUPAC name is [4-[[5-fluoro-4-(3-hydroxyanilino)pyrimidin-2-yl]amino]phenoxy]methyl N-methylcarbamate.
| Compound Name | [4-[[5-fluoro-4-(3-hydroxyanilino)pyrimidin-2-yl]amino]phenoxy]methyl N-methylcarbamate |
|---|---|
| PubChem CID | 174489135 |
| Molecular Formula | C19H18FN5O4 |
| Molecular Weight | 399.38 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | [4-[[5-fluoro-4-(3-hydroxyanilino)pyrimidin-2-yl]amino]phenoxy]methyl N-methylcarbamate |
| SMILES | CNC(=O)OCOc1ccc(Nc2ncc(F)c(Nc3cccc(O)c3)n2)cc1 |
| InChI | InChI=1S/C19H18FN5O4/c1-21-19(27)29-11-28-15-7-5-12(6-8-15)24-18-22-10-16(20)17(25-18)23-13-3-2-4-14(26)9-13/h2-10,26H,11H2,1H3,(H,21,27)(H2,22,23,24,25) |
| InChIKey | JTBBYHAGCYKICZ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 117.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.38 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|