C19H16FN5O2 — CID 22060324
3-[[5-fluoro-2-[[2-(hydroxymethyl)-1H-indol-5-yl]amino]pyrimidin-4-yl]amino]phenol (PubChem CID 22060324) has the molecular formula C19H16FN5O2 and a molecular weight of 365.37 g/mol. Its IUPAC name is 3-[[5-fluoro-2-[[2-(hydroxymethyl)-1H-indol-5-yl]amino]pyrimidin-4-yl]amino]phenol.
| Compound Name | 3-[[5-fluoro-2-[[2-(hydroxymethyl)-1H-indol-5-yl]amino]pyrimidin-4-yl]amino]phenol |
|---|---|
| PubChem CID | 22060324 |
| Molecular Formula | C19H16FN5O2 |
| Molecular Weight | 365.37 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | 3-[[5-fluoro-2-[[2-(hydroxymethyl)-1H-indol-5-yl]amino]pyrimidin-4-yl]amino]phenol |
| SMILES | OCc1cc2cc(Nc3ncc(F)c(Nc4cccc(O)c4)n3)ccc2[nH]1 |
| InChI | InChI=1S/C19H16FN5O2/c20-16-9-21-19(25-18(16)23-12-2-1-3-15(27)8-12)24-13-4-5-17-11(6-13)7-14(10-26)22-17/h1-9,22,26-27H,10H2,(H2,21,23,24,25) |
| InChIKey | QVQXVWXLPYNKKU-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.37 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |