About 2-N,4-N-bis(3-aminophenyl)-5-fluoropyrimidine-2,4-diamine;hydron
2-N,4-N-bis(3-aminophenyl)-5-fluoropyrimidine-2,4-diamine;hydron (PubChem CID 69247498) has the molecular formula C16H16FN6+
and a molecular weight of 311.34 g/mol. Its IUPAC name is 2-N,4-N-bis(3-aminophenyl)-5-fluoropyrimidine-2,4-diamine;hydron.
Molecular Properties
| Compound Name | 2-N,4-N-bis(3-aminophenyl)-5-fluoropyrimidine-2,4-diamine;hydron |
| PubChem CID | 69247498 |
| Molecular Formula | C16H16FN6+ |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 2-N,4-N-bis(3-aminophenyl)-5-fluoropyrimidine-2,4-diamine;hydron |
| SMILES | Nc1cccc(Nc2ncc(F)c(Nc3cccc(N)c3)n2)c1.[H+] |
| InChI | InChI=1S/C16H15FN6/c17-14-9-20-16(22-13-6-2-4-11(19)8-13)23-15(14)21-12-5-1-3-10(18)7-12/h1-9H,18-19H2,(H2,20,21,22,23)/p+1 |
| InChIKey | VDYYZYAHNFWOPX-UHFFFAOYSA-O |
| XLogP | 3.38 |
| TPSA | 101.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-N,4-N-bis(3-aminophenyl)-5-fluoropyrimidine-2,4-diamine;hydron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N,4-N-bis(3-aminophenyl)-5-fluoropyrimidine-2,4-diamine;hydron?
The IUPAC name of 2-N,4-N-bis(3-aminophenyl)-5-fluoropyrimidine-2,4-diamine;hydron (CID 69247498) is 2-N,4-N-bis(3-aminophenyl)-5-fluoropyrimidine-2,4-diamine;hydron.
What is the SMILES notation for 2-N,4-N-bis(3-aminophenyl)-5-fluoropyrimidine-2,4-diamine;hydron?
The canonical SMILES for 2-N,4-N-bis(3-aminophenyl)-5-fluoropyrimidine-2,4-diamine;hydron is Nc1cccc(Nc2ncc(F)c(Nc3cccc(N)c3)n2)c1.[H+].
What is the InChIKey of 2-N,4-N-bis(3-aminophenyl)-5-fluoropyrimidine-2,4-diamine;hydron?
The InChIKey is VDYYZYAHNFWOPX-UHFFFAOYSA-O. The full InChI is InChI=1S/C16H15FN6/c17-14-9-20-16(22-13-6-2-4-11(19)8-13)23-15(14)21-12-5-1-3-10(18)7-12/h1-9H,18-19H2,(H2,20,21,22,23)/p+1.
What are the key properties of 2-N,4-N-bis(3-aminophenyl)-5-fluoropyrimidine-2,4-diamine;hydron?
2-N,4-N-bis(3-aminophenyl)-5-fluoropyrimidine-2,4-diamine;hydron has a molecular weight of 311.34 g/mol, XLogP of 3.38, 4 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N,4-N-bis(3-aminophenyl)-5-fluoropyrimidine-2,4-diamine;hydron is sourced from PubChem (CID 69247498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).