C16H16FN6+ — CID 69247498
2-N,4-N-bis(3-aminophenyl)-5-fluoropyrimidine-2,4-diamine;hydron (PubChem CID 69247498) has the molecular formula C16H16FN6+ and a molecular weight of 311.34 g/mol. Its IUPAC name is 2-N,4-N-bis(3-aminophenyl)-5-fluoropyrimidine-2,4-diamine;hydron.
| Compound Name | 2-N,4-N-bis(3-aminophenyl)-5-fluoropyrimidine-2,4-diamine;hydron |
|---|---|
| PubChem CID | 69247498 |
| Molecular Formula | C16H16FN6+ |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 2-N,4-N-bis(3-aminophenyl)-5-fluoropyrimidine-2,4-diamine;hydron |
| SMILES | Nc1cccc(Nc2ncc(F)c(Nc3cccc(N)c3)n2)c1.[H+] |
| InChI | InChI=1S/C16H15FN6/c17-14-9-20-16(22-13-6-2-4-11(19)8-13)23-15(14)21-12-5-1-3-10(18)7-12/h1-9H,18-19H2,(H2,20,21,22,23)/p+1 |
| InChIKey | VDYYZYAHNFWOPX-UHFFFAOYSA-O |
| XLogP | 3.38 |
| TPSA | 101.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|