C18H19FN6 — CID 22060880
2-N,4-N-bis(3-amino-4-methylphenyl)-5-fluoropyrimidine-2,4-diamine (PubChem CID 22060880) has the molecular formula C18H19FN6 and a molecular weight of 338.39 g/mol. Its IUPAC name is 2-N,4-N-bis(3-amino-4-methylphenyl)-5-fluoropyrimidine-2,4-diamine.
| Compound Name | 2-N,4-N-bis(3-amino-4-methylphenyl)-5-fluoropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 22060880 |
| Molecular Formula | C18H19FN6 |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 2-N,4-N-bis(3-amino-4-methylphenyl)-5-fluoropyrimidine-2,4-diamine |
| SMILES | Cc1ccc(Nc2ncc(F)c(Nc3ccc(C)c(N)c3)n2)cc1N |
| InChI | InChI=1S/C18H19FN6/c1-10-3-5-12(7-15(10)20)23-17-14(19)9-22-18(25-17)24-13-6-4-11(2)16(21)8-13/h3-9H,20-21H2,1-2H3,(H2,22,23,24,25) |
| InChIKey | MEKSTNZFURDVRN-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 101.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|