C17H15ClFN5 — CID 142899048
2-N-(4-amino-3-methylphenyl)-4-N-(4-chlorophenyl)-5-fluoropyrimidine-2,4-diamine (PubChem CID 142899048) has the molecular formula C17H15ClFN5 and a molecular weight of 343.79 g/mol. Its IUPAC name is 2-N-(4-amino-3-methylphenyl)-4-N-(4-chlorophenyl)-5-fluoropyrimidine-2,4-diamine.
| Compound Name | 2-N-(4-amino-3-methylphenyl)-4-N-(4-chlorophenyl)-5-fluoropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 142899048 |
| Molecular Formula | C17H15ClFN5 |
| Molecular Weight | 343.79 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 2-N-(4-amino-3-methylphenyl)-4-N-(4-chlorophenyl)-5-fluoropyrimidine-2,4-diamine |
| SMILES | Cc1cc(Nc2ncc(F)c(Nc3ccc(Cl)cc3)n2)ccc1N |
| InChI | InChI=1S/C17H15ClFN5/c1-10-8-13(6-7-15(10)20)23-17-21-9-14(19)16(24-17)22-12-4-2-11(18)3-5-12/h2-9H,20H2,1H3,(H2,21,22,23,24) |
| InChIKey | QXJVUDLGBCVLKH-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.79 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|