C20H23FN6O2 — CID 22060532
2-N,4-N-bis(3-amino-4-ethoxyphenyl)-5-fluoropyrimidine-2,4-diamine (PubChem CID 22060532) has the molecular formula C20H23FN6O2 and a molecular weight of 398.44 g/mol. Its IUPAC name is 2-N,4-N-bis(3-amino-4-ethoxyphenyl)-5-fluoropyrimidine-2,4-diamine.
| Compound Name | 2-N,4-N-bis(3-amino-4-ethoxyphenyl)-5-fluoropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 22060532 |
| Molecular Formula | C20H23FN6O2 |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | 2-N,4-N-bis(3-amino-4-ethoxyphenyl)-5-fluoropyrimidine-2,4-diamine |
| SMILES | CCOc1ccc(Nc2ncc(F)c(Nc3ccc(OCC)c(N)c3)n2)cc1N |
| InChI | InChI=1S/C20H23FN6O2/c1-3-28-17-7-5-12(9-15(17)22)25-19-14(21)11-24-20(27-19)26-13-6-8-18(29-4-2)16(23)10-13/h5-11H,3-4,22-23H2,1-2H3,(H2,24,25,26,27) |
| InChIKey | VKIFJXURTPGOGT-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 120.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|