C17H15F2N5O — CID 139565423
4-N-(3-aminophenyl)-5-fluoro-2-N-(3-fluoro-4-methoxyphenyl)pyrimidine-2,4-diamine (PubChem CID 139565423) has the molecular formula C17H15F2N5O and a molecular weight of 343.34 g/mol. Its IUPAC name is 4-N-(3-aminophenyl)-5-fluoro-2-N-(3-fluoro-4-methoxyphenyl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-(3-aminophenyl)-5-fluoro-2-N-(3-fluoro-4-methoxyphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 139565423 |
| Molecular Formula | C17H15F2N5O |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 4-N-(3-aminophenyl)-5-fluoro-2-N-(3-fluoro-4-methoxyphenyl)pyrimidine-2,4-diamine |
| SMILES | COc1ccc(Nc2ncc(F)c(Nc3cccc(N)c3)n2)cc1F |
| InChI | InChI=1S/C17H15F2N5O/c1-25-15-6-5-12(8-13(15)18)23-17-21-9-14(19)16(24-17)22-11-4-2-3-10(20)7-11/h2-9H,20H2,1H3,(H2,21,22,23,24) |
| InChIKey | QZKGJSJMIINKAM-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|