C17H16FN5O — CID 89188920
2-N-(5-amino-2-methoxyphenyl)-5-fluoro-4-N-phenylpyrimidine-2,4-diamine (PubChem CID 89188920) has the molecular formula C17H16FN5O and a molecular weight of 325.35 g/mol. Its IUPAC name is 2-N-(5-amino-2-methoxyphenyl)-5-fluoro-4-N-phenylpyrimidine-2,4-diamine.
| Compound Name | 2-N-(5-amino-2-methoxyphenyl)-5-fluoro-4-N-phenylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 89188920 |
| Molecular Formula | C17H16FN5O |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 2-N-(5-amino-2-methoxyphenyl)-5-fluoro-4-N-phenylpyrimidine-2,4-diamine |
| SMILES | COc1ccc(N)cc1Nc1ncc(F)c(Nc2ccccc2)n1 |
| InChI | InChI=1S/C17H16FN5O/c1-24-15-8-7-11(19)9-14(15)22-17-20-10-13(18)16(23-17)21-12-5-3-2-4-6-12/h2-10H,19H2,1H3,(H2,20,21,22,23) |
| InChIKey | BIYFPYMUCDDBLO-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|